About carbon monoxide;rhenium;triphenylphosphane
carbon monoxide;rhenium;triphenylphosphane (PubChem CID 139109889) has the molecular formula C22H15O4PRe
and a molecular weight of 560.54 g/mol. Its IUPAC name is carbon monoxide;rhenium;triphenylphosphane.
Molecular Properties
| Compound Name | carbon monoxide;rhenium;triphenylphosphane |
| PubChem CID | 139109889 |
| Molecular Formula | C22H15O4PRe |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 561.03 |
| IUPAC Name | carbon monoxide;rhenium;triphenylphosphane |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Re].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.4CO.Re/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4*1-2;/h1-15H;;;;; |
| InChIKey | YSFUHCJNFBLIKK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;rhenium;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;rhenium;triphenylphosphane?
The IUPAC name of carbon monoxide;rhenium;triphenylphosphane (CID 139109889) is carbon monoxide;rhenium;triphenylphosphane.
What is the SMILES notation for carbon monoxide;rhenium;triphenylphosphane?
The canonical SMILES for carbon monoxide;rhenium;triphenylphosphane is [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Re].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of carbon monoxide;rhenium;triphenylphosphane?
The InChIKey is YSFUHCJNFBLIKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.4CO.Re/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4*1-2;/h1-15H;;;;;.
What are the key properties of carbon monoxide;rhenium;triphenylphosphane?
carbon monoxide;rhenium;triphenylphosphane has a molecular weight of 560.54 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;rhenium;triphenylphosphane is sourced from PubChem (CID 139109889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).