About dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate
dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate (PubChem CID 139110423) has the molecular formula C17H21BN2NiO2
and a molecular weight of 354.87 g/mol. Its IUPAC name is dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate.
Molecular Properties
| Compound Name | dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate |
| PubChem CID | 139110423 |
| Molecular Formula | C17H21BN2NiO2 |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate |
| SMILES | CC(=O)/C=C(/C)[O-].C[B-](C)(c1ccccn1)c1ccccn1.[Ni+2] |
| InChI | InChI=1S/C12H14BN2.C5H8O2.Ni/c1-13(2,11-7-3-5-9-14-11)12-8-4-6-10-15-12;1-4(6)3-5(2)7;/h3-10H,1-2H3;3,6H,1-2H3;/q-1;;+2/p-1/b;4-3-; |
| InChIKey | NHRUAUHYQGFPIF-LWFKIUJUSA-M |
| XLogP | 1.14 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate?
The IUPAC name of dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate (CID 139110423) is dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate.
What is the SMILES notation for dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate?
The canonical SMILES for dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate is CC(=O)/C=C(/C)[O-].C[B-](C)(c1ccccn1)c1ccccn1.[Ni+2].
What is the InChIKey of dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate?
The InChIKey is NHRUAUHYQGFPIF-LWFKIUJUSA-M. The full InChI is InChI=1S/C12H14BN2.C5H8O2.Ni/c1-13(2,11-7-3-5-9-14-11)12-8-4-6-10-15-12;1-4(6)3-5(2)7;/h3-10H,1-2H3;3,6H,1-2H3;/q-1;;+2/p-1/b;4-3-;.
What are the key properties of dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate?
dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate has a molecular weight of 354.87 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(dipyridin-2-yl)boranuide;nickel(2+);(Z)-4-oxopent-2-en-2-olate is sourced from PubChem (CID 139110423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).