About CID 139110935
CID 139110935 (PubChem CID 139110935) has the molecular formula C24H56Ge4Si2
and a molecular weight of 691.32 g/mol.
Molecular Properties
| Compound Name | CID 139110935 |
| PubChem CID | 139110935 |
| Molecular Formula | C24H56Ge4Si2 |
| Molecular Weight | 691.32 g/mol |
| Exact Mass | 696.08 |
| IUPAC Name | — |
| SMILES | CCC1=C(CC)[Si]C(CC)=C(CC)[Si]1.C[Ge](C)C.C[Ge](C)C.C[Ge](C)C.C[Ge](C)C |
| InChI | InChI=1S/C12H20Si2.4C3H9Ge/c1-5-9-10(6-2)14-12(8-4)11(7-3)13-9;4*1-4(2)3/h5-8H2,1-4H3;4*1-3H3 |
| InChIKey | MRMVMGPXVDKTOO-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 691.32 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139110935 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139110935?
The IUPAC name of CID 139110935 (CID 139110935) is not available.
What is the SMILES notation for CID 139110935?
The canonical SMILES for CID 139110935 is CCC1=C(CC)[Si]C(CC)=C(CC)[Si]1.C[Ge](C)C.C[Ge](C)C.C[Ge](C)C.C[Ge](C)C.
What is the InChIKey of CID 139110935?
The InChIKey is MRMVMGPXVDKTOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20Si2.4C3H9Ge/c1-5-9-10(6-2)14-12(8-4)11(7-3)13-9;4*1-4(2)3/h5-8H2,1-4H3;4*1-3H3.
What are the key properties of CID 139110935?
CID 139110935 has a molecular weight of 691.32 g/mol, XLogP of 8.95, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139110935 is sourced from PubChem (CID 139110935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).