C87H110OSn2 — CID 139111184
[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-[5-[[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-λ2-stannanyl]-9,9-dimethylxanthen-4-yl]tin (PubChem CID 139111184) has the molecular formula C87H110OSn2 and a molecular weight of 1409.26 g/mol. Its IUPAC name is [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-[5-[[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-λ2-stannanyl]-9,9-dimethylxanthen-4-yl]tin.
| Compound Name | [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-[5-[[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-λ2-stannanyl]-9,9-dimethylxanthen-4-yl]tin |
|---|---|
| PubChem CID | 139111184 |
| Molecular Formula | C87H110OSn2 |
| Molecular Weight | 1409.26 g/mol |
| Exact Mass | 1410.66 |
| IUPAC Name | [2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-[5-[[2,6-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]-λ2-stannanyl]-9,9-dimethylxanthen-4-yl]tin |
| SMILES | CC(C)c1cc(C(C)C)c(-c2cccc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2[Sn]c2cccc3c2Oc2c([Sn]c4c(-c5c(C(C)C)cc(C(C)C)cc5C(C)C)cccc4-c4c(C(C)C)cc(C(C)C)cc4C(C)C)cccc2C3(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/2C36H49.C15H12O.2Sn/c2*1-21(2)29-17-31(23(5)6)35(32(18-29)24(7)8)27-14-13-15-28(16-27)36-33(25(9)10)19-30(22(3)4)20-34(36)26(11)12;1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15;;/h2*13-15,17-26H,1-12H3;3-8H,1-2H3;; |
| InChIKey | BZSYUPBVDZPYAZ-UHFFFAOYSA-N |
| XLogP | 23.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1409.26 |
| LogP ≤ 5 | 23.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |