C48H92N4P4Si2 — CID 139111762
ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2H-1,3,2-benzodiazasilol-1-yl]methyl]phosphane (PubChem CID 139111762) has the molecular formula C48H92N4P4Si2 and a molecular weight of 905.36 g/mol. Its IUPAC name is ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2H-1,3,2-benzodiazasilol-1-yl]methyl]phosphane.
| Compound Name | ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2H-1,3,2-benzodiazasilol-1-yl]methyl]phosphane |
|---|---|
| PubChem CID | 139111762 |
| Molecular Formula | C48H92N4P4Si2 |
| Molecular Weight | 905.36 g/mol |
| Exact Mass | 904.58 |
| IUPAC Name | ditert-butyl-[[3-(ditert-butylphosphanylmethyl)-2H-1,3,2-benzodiazasilol-1-yl]methyl]phosphane |
| SMILES | CC(C)(C)P(CN1[SiH2]N(CP(C(C)(C)C)C(C)(C)C)c2ccccc21)C(C)(C)C.CC(C)(C)P(CN1[SiH2]N(CP(C(C)(C)C)C(C)(C)C)c2ccccc21)C(C)(C)C |
| InChI | InChI=1S/2C24H46N2P2Si/c2*1-21(2,3)27(22(4,5)6)17-25-19-15-13-14-16-20(19)26(29-25)18-28(23(7,8)9)24(10,11)12/h2*13-16H,17-18,29H2,1-12H3 |
| InChIKey | IADACOMNLJOVQG-UHFFFAOYSA-N |
| XLogP | 14.77 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.36 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|