C26H24N3+ — CID 139112602
3-butyl-4,5-diphenylimidazo[1,2-a][1,6]naphthyridin-3-ium (PubChem CID 139112602) has the molecular formula C26H24N3+ and a molecular weight of 378.50 g/mol. Its IUPAC name is 3-butyl-4,5-diphenylimidazo[1,2-a][1,6]naphthyridin-3-ium.
| Compound Name | 3-butyl-4,5-diphenylimidazo[1,2-a][1,6]naphthyridin-3-ium |
|---|---|
| PubChem CID | 139112602 |
| Molecular Formula | C26H24N3+ |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 3-butyl-4,5-diphenylimidazo[1,2-a][1,6]naphthyridin-3-ium |
| SMILES | CCCC[n+]1ccn2c3ccncc3c(-c3ccccc3)c(-c3ccccc3)c21 |
| InChI | InChI=1S/C26H24N3/c1-2-3-16-28-17-18-29-23-14-15-27-19-22(23)24(20-10-6-4-7-11-20)25(26(28)29)21-12-8-5-9-13-21/h4-15,17-19H,2-3,16H2,1H3/q+1 |
| InChIKey | IFHAFFLAFOATCL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|