About 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole
5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole (PubChem CID 139113275) has the molecular formula C42H20B2F18
and a molecular weight of 888.21 g/mol. Its IUPAC name is 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole.
Molecular Properties
| Compound Name | 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole |
| PubChem CID | 139113275 |
| Molecular Formula | C42H20B2F18 |
| Molecular Weight | 888.21 g/mol |
| Exact Mass | 888.15 |
| IUPAC Name | 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c(B2c3ccccc3-c3ccccc32)c(C(F)(F)F)c1.FC(F)(F)c1cc(C(F)(F)F)c(B2c3ccccc3-c3ccccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/2C21H10BF9/c2*23-19(24,25)11-9-14(20(26,27)28)18(15(10-11)21(29,30)31)22-16-7-3-1-5-12(16)13-6-2-4-8-17(13)22/h2*1-10H |
| InChIKey | HYHMEQCKVVALKI-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 888.21 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole?
The IUPAC name of 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole (CID 139113275) is 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole.
What is the SMILES notation for 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole?
The canonical SMILES for 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole is FC(F)(F)c1cc(C(F)(F)F)c(B2c3ccccc3-c3ccccc32)c(C(F)(F)F)c1.FC(F)(F)c1cc(C(F)(F)F)c(B2c3ccccc3-c3ccccc32)c(C(F)(F)F)c1.
What is the InChIKey of 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole?
The InChIKey is HYHMEQCKVVALKI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C21H10BF9/c2*23-19(24,25)11-9-14(20(26,27)28)18(15(10-11)21(29,30)31)22-16-7-3-1-5-12(16)13-6-2-4-8-17(13)22/h2*1-10H.
What are the key properties of 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole?
5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole has a molecular weight of 888.21 g/mol, XLogP of 10.48, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,4,6-tris(trifluoromethyl)phenyl]benzo[b][1]benzoborole is sourced from PubChem (CID 139113275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).