About CID 139113469
CID 139113469 (PubChem CID 139113469) has the molecular formula C39H15BF12N6-
and a molecular weight of 806.38 g/mol.
Molecular Properties
| Compound Name | CID 139113469 |
| PubChem CID | 139113469 |
| Molecular Formula | C39H15BF12N6- |
| Molecular Weight | 806.38 g/mol |
| Exact Mass | 806.13 |
| IUPAC Name | — |
| SMILES | Fc1c(F)c(F)c2c(c(-c3ccccc3)nn2[B-](n2nc(-c3ccccc3)c3c(F)c(F)c(F)c(F)c32)n2nc(-c3ccccc3)c3c(F)c(F)c(F)c(F)c32)c1F |
| InChI | InChI=1S/C39H15BF12N6/c41-22-19-34(16-10-4-1-5-11-16)53-56(37(19)31(50)28(47)25(22)44)40(57-38-20(23(42)26(45)29(48)32(38)51)35(54-57)17-12-6-2-7-13-17)58-39-21(24(43)27(46)30(49)33(39)52)36(55-58)18-14-8-3-9-15-18/h1-15H/q-1 |
| InChIKey | GSGWFDFSLXHOPS-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 806.38 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139113469 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139113469?
The IUPAC name of CID 139113469 (CID 139113469) is not available.
What is the SMILES notation for CID 139113469?
The canonical SMILES for CID 139113469 is Fc1c(F)c(F)c2c(c(-c3ccccc3)nn2[B-](n2nc(-c3ccccc3)c3c(F)c(F)c(F)c(F)c32)n2nc(-c3ccccc3)c3c(F)c(F)c(F)c(F)c32)c1F.
What is the InChIKey of CID 139113469?
The InChIKey is GSGWFDFSLXHOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H15BF12N6/c41-22-19-34(16-10-4-1-5-11-16)53-56(37(19)31(50)28(47)25(22)44)40(57-38-20(23(42)26(45)29(48)32(38)51)35(54-57)17-12-6-2-7-13-17)58-39-21(24(43)27(46)30(49)33(39)52)36(55-58)18-14-8-3-9-15-18/h1-15H/q-1.
What are the key properties of CID 139113469?
CID 139113469 has a molecular weight of 806.38 g/mol, XLogP of 10.34, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139113469 is sourced from PubChem (CID 139113469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).