C28H32N2O — CID 139114526
(E,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-2,3,3-triphenylpropan-1-imine (PubChem CID 139114526) has the molecular formula C28H32N2O and a molecular weight of 412.58 g/mol. Its IUPAC name is (E,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-2,3,3-triphenylpropan-1-imine.
| Compound Name | (E,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-2,3,3-triphenylpropan-1-imine |
|---|---|
| PubChem CID | 139114526 |
| Molecular Formula | C28H32N2O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (E,2S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-methyl-2,3,3-triphenylpropan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@](C)(c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N2O/c1-28(25-17-10-5-11-18-25,22-29-30-20-12-19-26(30)21-31-2)27(23-13-6-3-7-14-23)24-15-8-4-9-16-24/h3-11,13-18,22,26-27H,12,19-21H2,1-2H3/b29-22+/t26-,28+/m0/s1 |
| InChIKey | CBRFDIZOQGZHFO-KSVHDBGWSA-N |
| XLogP | 5.87 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|