C19H24O4S — CID 139114870
(1aS,2aS,6aR,7aR)-2a-(benzenesulfonylmethyl)-1a,7a-dimethyl-2,4,5,6,6a,7-hexahydronaphtho[6,7-b]oxiren-3-one (PubChem CID 139114870) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is (1aS,2aS,6aR,7aR)-2a-(benzenesulfonylmethyl)-1a,7a-dimethyl-2,4,5,6,6a,7-hexahydronaphtho[6,7-b]oxiren-3-one.
| Compound Name | (1aS,2aS,6aR,7aR)-2a-(benzenesulfonylmethyl)-1a,7a-dimethyl-2,4,5,6,6a,7-hexahydronaphtho[6,7-b]oxiren-3-one |
|---|---|
| PubChem CID | 139114870 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (1aS,2aS,6aR,7aR)-2a-(benzenesulfonylmethyl)-1a,7a-dimethyl-2,4,5,6,6a,7-hexahydronaphtho[6,7-b]oxiren-3-one |
| SMILES | C[C@@]12C[C@H]3CCCC(=O)[C@]3(CS(=O)(=O)c3ccccc3)C[C@]1(C)O2 |
| InChI | InChI=1S/C19H24O4S/c1-17-11-14-7-6-10-16(20)19(14,12-18(17,2)23-17)13-24(21,22)15-8-4-3-5-9-15/h3-5,8-9,14H,6-7,10-13H2,1-2H3/t14-,17-,18+,19+/m1/s1 |
| InChIKey | DHIQOVXDSNCBKC-OAOYMFHYSA-N |
| XLogP | 3.16 |
| TPSA | 63.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|