C16H26O2 — CID 139114976
(1S,3S,3aS,7S,7aS)-4-methylidene-3-(2-methylprop-2-enyl)-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-ol (PubChem CID 139114976) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (1S,3S,3aS,7S,7aS)-4-methylidene-3-(2-methylprop-2-enyl)-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-ol.
| Compound Name | (1S,3S,3aS,7S,7aS)-4-methylidene-3-(2-methylprop-2-enyl)-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-ol |
|---|---|
| PubChem CID | 139114976 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (1S,3S,3aS,7S,7aS)-4-methylidene-3-(2-methylprop-2-enyl)-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-2-benzofuran-1-ol |
| SMILES | C=C(C)C[C@@H]1O[C@H](O)[C@@H]2[C@H]1C(=C)CC[C@H]2C(C)C |
| InChI | InChI=1S/C16H26O2/c1-9(2)8-13-14-11(5)6-7-12(10(3)4)15(14)16(17)18-13/h10,12-17H,1,5-8H2,2-4H3/t12-,13-,14-,15-,16-/m0/s1 |
| InChIKey | KYTYDJLKGRGTMB-QXKUPLGCSA-N |
| XLogP | 3.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|