C60H52N4O8 — CID 139115175
[2,4-bis(4-methoxyphenyl)-3-(pyridine-4-carbonyl)cyclobutyl]-pyridin-4-ylmethanone (PubChem CID 139115175) has the molecular formula C60H52N4O8 and a molecular weight of 957.10 g/mol. Its IUPAC name is [2,4-bis(4-methoxyphenyl)-3-(pyridine-4-carbonyl)cyclobutyl]-pyridin-4-ylmethanone.
| Compound Name | [2,4-bis(4-methoxyphenyl)-3-(pyridine-4-carbonyl)cyclobutyl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 139115175 |
| Molecular Formula | C60H52N4O8 |
| Molecular Weight | 957.10 g/mol |
| Exact Mass | 956.38 |
| IUPAC Name | [2,4-bis(4-methoxyphenyl)-3-(pyridine-4-carbonyl)cyclobutyl]-pyridin-4-ylmethanone |
| SMILES | COc1ccc([C@H]2[C@@H](C(=O)c3ccncc3)[C@@H](c3ccc(OC)cc3)[C@H]2C(=O)c2ccncc2)cc1.COc1ccc([C@H]2[C@@H](C(=O)c3ccncc3)[C@@H](c3ccc(OC)cc3)[C@H]2C(=O)c2ccncc2)cc1 |
| InChI | InChI=1S/2C30H26N2O4/c2*1-35-23-7-3-19(4-8-23)25-27(29(33)21-11-15-31-16-12-21)26(20-5-9-24(36-2)10-6-20)28(25)30(34)22-13-17-32-18-14-22/h2*3-18,25-28H,1-2H3/t2*25-,26+,27+,28- |
| InChIKey | OZCLZJAVAKQPMK-XVCDSBKMSA-N |
| XLogP | 10.75 |
| TPSA | 156.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.10 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |