C48H41Cl2N7O6 — CID 139115401
acetonitrile;4',5'-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2',7'-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydrate (PubChem CID 139115401) has the molecular formula C48H41Cl2N7O6 and a molecular weight of 882.81 g/mol. Its IUPAC name is acetonitrile;4',5'-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2',7'-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydrate.
| Compound Name | acetonitrile;4',5'-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2',7'-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydrate |
|---|---|
| PubChem CID | 139115401 |
| Molecular Formula | C48H41Cl2N7O6 |
| Molecular Weight | 882.81 g/mol |
| Exact Mass | 881.25 |
| IUPAC Name | acetonitrile;4',5'-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-2',7'-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one;hydrate |
| SMILES | CC#N.O.O=C1OC2(c3ccccc31)c1cc(Cl)c(O)c(CN(Cc3ccccn3)Cc3ccccn3)c1Oc1c2cc(Cl)c(O)c1CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C46H36Cl2N6O5.C2H3N.H2O/c47-39-21-37-43(34(41(39)55)27-53(23-29-11-3-7-17-49-29)24-30-12-4-8-18-50-30)58-44-35(28-54(25-31-13-5-9-19-51-31)26-32-14-6-10-20-52-32)42(56)40(48)22-38(44)46(37)36-16-2-1-15-33(36)45(57)59-46;1-2-3;/h1-22,55-56H,23-28H2;1H3;1H2 |
| InChIKey | NBDYPORHWRBOJB-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 189.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.81 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|