C44H20F8N4 — CID 139115757
5,10,15,20-tetrakis(2,6-difluorophenyl)porphyrin (PubChem CID 139115757) has the molecular formula C44H20F8N4 and a molecular weight of 756.66 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,6-difluorophenyl)porphyrin.
| Compound Name | 5,10,15,20-tetrakis(2,6-difluorophenyl)porphyrin |
|---|---|
| PubChem CID | 139115757 |
| Molecular Formula | C44H20F8N4 |
| Molecular Weight | 756.66 g/mol |
| Exact Mass | 756.16 |
| IUPAC Name | 5,10,15,20-tetrakis(2,6-difluorophenyl)porphyrin |
| SMILES | Fc1cccc(F)c1/C1=C2\C=CC(=N2)/C(c2c(F)cccc2F)=C2/C=CC(=N2)/C(c2c(F)cccc2F)=C2/C=CC(=N2)/C(c2c(F)cccc2F)=C2/C=CC1=N2 |
| InChI | InChI=1S/C44H20F8N4/c45-21-5-1-6-22(46)37(21)41-29-13-15-31(53-29)42(38-23(47)7-2-8-24(38)48)33-17-19-35(55-33)44(40-27(51)11-4-12-28(40)52)36-20-18-34(56-36)43(32-16-14-30(41)54-32)39-25(49)9-3-10-26(39)50/h1-20H/b41-29+,41-30+,42-31+,42-33+,43-32+,43-34+,44-35+,44-36+ |
| InChIKey | YRBLHGCXXJQXTG-DSIMAETFSA-N |
| XLogP | 10.80 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.66 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |