C19H20N2OS — CID 139115811
(4R)-1-benzyl-4-(furan-2-yl)-3,4,5,6,7,8-hexahydroquinazoline-2-thione (PubChem CID 139115811) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is (4R)-1-benzyl-4-(furan-2-yl)-3,4,5,6,7,8-hexahydroquinazoline-2-thione.
| Compound Name | (4R)-1-benzyl-4-(furan-2-yl)-3,4,5,6,7,8-hexahydroquinazoline-2-thione |
|---|---|
| PubChem CID | 139115811 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (4R)-1-benzyl-4-(furan-2-yl)-3,4,5,6,7,8-hexahydroquinazoline-2-thione |
| SMILES | S=C1N[C@@H](c2ccco2)C2=C(CCCC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H20N2OS/c23-19-20-18(17-11-6-12-22-17)15-9-4-5-10-16(15)21(19)13-14-7-2-1-3-8-14/h1-3,6-8,11-12,18H,4-5,9-10,13H2,(H,20,23)/t18-/m1/s1 |
| InChIKey | ZPIPZANLNALCGK-GOSISDBHSA-N |
| XLogP | 4.54 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|