C55H35F6N7O+4 — CID 139115919
3-(imidazol-1-ylmethyl)-N-[2-[10,15,20-tris(2,6-difluorophenyl)-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium-5-yl]phenyl]benzamide (PubChem CID 139115919) has the molecular formula C55H35F6N7O+4 and a molecular weight of 923.92 g/mol. Its IUPAC name is 3-(imidazol-1-ylmethyl)-N-[2-[10,15,20-tris(2,6-difluorophenyl)-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium-5-yl]phenyl]benzamide.
| Compound Name | 3-(imidazol-1-ylmethyl)-N-[2-[10,15,20-tris(2,6-difluorophenyl)-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 139115919 |
| Molecular Formula | C55H35F6N7O+4 |
| Molecular Weight | 923.92 g/mol |
| Exact Mass | 923.28 |
| IUPAC Name | 3-(imidazol-1-ylmethyl)-N-[2-[10,15,20-tris(2,6-difluorophenyl)-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium-5-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1[C+]1c2ccc([nH]2)[C+](c2c(F)cccc2F)c2ccc([nH]2)[C+](c2c(F)cccc2F)c2ccc([nH]2)[C+](c2c(F)cccc2F)c2ccc1[nH]2)c1cccc(Cn2ccnc2)c1 |
| InChI | InChI=1S/C55H34F6N7O/c56-33-10-4-11-34(57)49(33)52-42-19-17-40(63-42)48(32-9-1-2-16-39(32)67-55(69)31-8-3-7-30(27-31)28-68-26-25-62-29-68)41-18-20-43(64-41)53(50-35(58)12-5-13-36(50)59)45-22-24-47(66-45)54(46-23-21-44(52)65-46)51-37(60)14-6-15-38(51)61/h1-27,29,63-66H,28H2/q+3/p+1 |
| InChIKey | INDMLHBCIALEMY-UHFFFAOYSA-O |
| XLogP | 11.72 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.92 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|