About N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide
N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide (PubChem CID 139115960) has the molecular formula C17H19NO2S
and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide |
| PubChem CID | 139115960 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@@]1(c2ccccc2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19NO2S/c1-21(19,20)18-13-17(15-10-6-3-7-11-15)12-16(17)14-8-4-2-5-9-14/h2-11,16,18H,12-13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | ROONSPXJFGTLDQ-IAGOWNOFSA-N |
| XLogP | 2.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide?
The IUPAC name of N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide (CID 139115960) is N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide?
The canonical SMILES for N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide is CS(=O)(=O)NC[C@@]1(c2ccccc2)C[C@@H]1c1ccccc1.
What is the InChIKey of N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide?
The InChIKey is ROONSPXJFGTLDQ-IAGOWNOFSA-N. The full InChI is InChI=1S/C17H19NO2S/c1-21(19,20)18-13-17(15-10-6-3-7-11-15)12-16(17)14-8-4-2-5-9-14/h2-11,16,18H,12-13H2,1H3/t16-,17-/m1/s1.
What are the key properties of N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide?
N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide has a molecular weight of 301.41 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1S,2R)-1,2-diphenylcyclopropyl]methyl]methanesulfonamide is sourced from PubChem (CID 139115960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).