C28H31BF2N4 — CID 139115975
5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-8-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139115975) has the molecular formula C28H31BF2N4 and a molecular weight of 472.39 g/mol. Its IUPAC name is 5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-8-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-8-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139115975 |
| Molecular Formula | C28H31BF2N4 |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-8-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CCC1=C(C)C2=C(c3ccnc(-c4cc(C)ccn4)c3)c3c(C)c(CC)c(C)n3[B-](F)(F)[N+]2=C1C |
| InChI | InChI=1S/C28H31BF2N4/c1-8-22-17(4)27-26(21-11-13-33-25(15-21)24-14-16(3)10-12-32-24)28-18(5)23(9-2)20(7)35(28)29(30,31)34(27)19(22)6/h10-15H,8-9H2,1-7H3 |
| InChIKey | GSZLIRNAOZRDFJ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 33.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|