C42H72N6Si3 — CID 139116116
1-N,3-N,5-N-tris[2-[[tert-butyl(dimethyl)silyl]amino]phenyl]cyclohexane-1,3,5-triamine (PubChem CID 139116116) has the molecular formula C42H72N6Si3 and a molecular weight of 745.34 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris[2-[[tert-butyl(dimethyl)silyl]amino]phenyl]cyclohexane-1,3,5-triamine.
| Compound Name | 1-N,3-N,5-N-tris[2-[[tert-butyl(dimethyl)silyl]amino]phenyl]cyclohexane-1,3,5-triamine |
|---|---|
| PubChem CID | 139116116 |
| Molecular Formula | C42H72N6Si3 |
| Molecular Weight | 745.34 g/mol |
| Exact Mass | 744.51 |
| IUPAC Name | 1-N,3-N,5-N-tris[2-[[tert-butyl(dimethyl)silyl]amino]phenyl]cyclohexane-1,3,5-triamine |
| SMILES | CC(C)(C)[Si](C)(C)Nc1ccccc1NC1CC(Nc2ccccc2N[Si](C)(C)C(C)(C)C)CC(Nc2ccccc2N[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C42H72N6Si3/c1-40(2,3)49(10,11)46-37-25-19-16-22-34(37)43-31-28-32(44-35-23-17-20-26-38(35)47-50(12,13)41(4,5)6)30-33(29-31)45-36-24-18-21-27-39(36)48-51(14,15)42(7,8)9/h16-27,31-33,43-48H,28-30H2,1-15H3 |
| InChIKey | NAUJRMXHVJRXRV-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.34 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|