C31H36N2O4 — CID 139116484
propan-2-yl (5R,9S)-1,3-dibenzyl-9-(cyclopentylmethyl)-2,4-dioxo-1,3-diazaspiro[4.4]non-7-ene-7-carboxylate (PubChem CID 139116484) has the molecular formula C31H36N2O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is propan-2-yl (5R,9S)-1,3-dibenzyl-9-(cyclopentylmethyl)-2,4-dioxo-1,3-diazaspiro[4.4]non-7-ene-7-carboxylate.
| Compound Name | propan-2-yl (5R,9S)-1,3-dibenzyl-9-(cyclopentylmethyl)-2,4-dioxo-1,3-diazaspiro[4.4]non-7-ene-7-carboxylate |
|---|---|
| PubChem CID | 139116484 |
| Molecular Formula | C31H36N2O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | propan-2-yl (5R,9S)-1,3-dibenzyl-9-(cyclopentylmethyl)-2,4-dioxo-1,3-diazaspiro[4.4]non-7-ene-7-carboxylate |
| SMILES | CC(C)OC(=O)C1=C[C@H](CC2CCCC2)[C@]2(C1)C(=O)N(Cc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C31H36N2O4/c1-22(2)37-28(34)26-18-27(17-23-11-9-10-12-23)31(19-26)29(35)32(20-24-13-5-3-6-14-24)30(36)33(31)21-25-15-7-4-8-16-25/h3-8,13-16,18,22-23,27H,9-12,17,19-21H2,1-2H3/t27-,31+/m0/s1 |
| InChIKey | YAUCWFWSYDIPQT-JTSJOTPCSA-N |
| XLogP | 5.87 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|