About 4,4-dimethyl-1,4-azasilepan-1-ium chloride
4,4-dimethyl-1,4-azasilepan-1-ium chloride (PubChem CID 139116583) has the molecular formula C7H18ClNSi
and a molecular weight of 179.77 g/mol. Its IUPAC name is 4,4-dimethyl-1,4-azasilepan-1-ium chloride.
Molecular Properties
| Compound Name | 4,4-dimethyl-1,4-azasilepan-1-ium chloride |
| PubChem CID | 139116583 |
| Molecular Formula | C7H18ClNSi |
| Molecular Weight | 179.77 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4,4-dimethyl-1,4-azasilepan-1-ium chloride |
| SMILES | C[Si]1(C)CCC[NH2+]CC1.[Cl-] |
| InChI | InChI=1S/C7H17NSi.ClH/c1-9(2)6-3-4-8-5-7-9;/h8H,3-7H2,1-2H3;1H |
| InChIKey | ZAXRMKBMFYIHJB-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.77 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-1,4-azasilepan-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-1,4-azasilepan-1-ium chloride?
The IUPAC name of 4,4-dimethyl-1,4-azasilepan-1-ium chloride (CID 139116583) is 4,4-dimethyl-1,4-azasilepan-1-ium chloride.
What is the SMILES notation for 4,4-dimethyl-1,4-azasilepan-1-ium chloride?
The canonical SMILES for 4,4-dimethyl-1,4-azasilepan-1-ium chloride is C[Si]1(C)CCC[NH2+]CC1.[Cl-].
What is the InChIKey of 4,4-dimethyl-1,4-azasilepan-1-ium chloride?
The InChIKey is ZAXRMKBMFYIHJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NSi.ClH/c1-9(2)6-3-4-8-5-7-9;/h8H,3-7H2,1-2H3;1H.
What are the key properties of 4,4-dimethyl-1,4-azasilepan-1-ium chloride?
4,4-dimethyl-1,4-azasilepan-1-ium chloride has a molecular weight of 179.77 g/mol, XLogP of -2.33, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-1,4-azasilepan-1-ium chloride is sourced from PubChem (CID 139116583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).