C27H26N2 — CID 139117102
1,3-bis(2,7-dimethylnaphthalen-1-yl)-4,5-dihydro-2H-imidazol-1-ium-2-ide (PubChem CID 139117102) has the molecular formula C27H26N2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1,3-bis(2,7-dimethylnaphthalen-1-yl)-4,5-dihydro-2H-imidazol-1-ium-2-ide.
| Compound Name | 1,3-bis(2,7-dimethylnaphthalen-1-yl)-4,5-dihydro-2H-imidazol-1-ium-2-ide |
|---|---|
| PubChem CID | 139117102 |
| Molecular Formula | C27H26N2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1,3-bis(2,7-dimethylnaphthalen-1-yl)-4,5-dihydro-2H-imidazol-1-ium-2-ide |
| SMILES | Cc1ccc2ccc(C)c(N3[C-]=[N+](c4c(C)ccc5ccc(C)cc45)CC3)c2c1 |
| InChI | InChI=1S/C27H26N2/c1-18-5-9-22-11-7-20(3)26(24(22)15-18)28-13-14-29(17-28)27-21(4)8-12-23-10-6-19(2)16-25(23)27/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | QBPYHBXHBZRJFW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|