About 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile
2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile (PubChem CID 139117209) has the molecular formula C48H36N12
and a molecular weight of 780.90 g/mol. Its IUPAC name is 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile |
| PubChem CID | 139117209 |
| Molecular Formula | C48H36N12 |
| Molecular Weight | 780.90 g/mol |
| Exact Mass | 780.32 |
| IUPAC Name | 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc([C@H]2C[C@@H](c3cc(C#N)ccn3)C[C@@H](c3cc(C#N)ccn3)C2)c1.N#Cc1ccnc([C@H]2C[C@@H](c3cc(C#N)ccn3)C[C@@H](c3cc(C#N)ccn3)C2)c1 |
| InChI | InChI=1S/2C24H18N6/c2*25-13-16-1-4-28-22(7-16)19-10-20(23-8-17(14-26)2-5-29-23)12-21(11-19)24-9-18(15-27)3-6-30-24/h2*1-9,19-21H,10-12H2/t2*19-,20+,21- |
| InChIKey | OUITWWIFEFISFM-RNPAGWERSA-N |
| XLogP | 8.64 |
| TPSA | 220.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 780.90 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile?
The IUPAC name of 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile (CID 139117209) is 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile.
What is the SMILES notation for 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile?
The canonical SMILES for 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile is N#Cc1ccnc([C@H]2C[C@@H](c3cc(C#N)ccn3)C[C@@H](c3cc(C#N)ccn3)C2)c1.N#Cc1ccnc([C@H]2C[C@@H](c3cc(C#N)ccn3)C[C@@H](c3cc(C#N)ccn3)C2)c1.
What is the InChIKey of 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile?
The InChIKey is OUITWWIFEFISFM-RNPAGWERSA-N. The full InChI is InChI=1S/2C24H18N6/c2*25-13-16-1-4-28-22(7-16)19-10-20(23-8-17(14-26)2-5-29-23)12-21(11-19)24-9-18(15-27)3-6-30-24/h2*1-9,19-21H,10-12H2/t2*19-,20+,21-.
What are the key properties of 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile?
2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile has a molecular weight of 780.90 g/mol, XLogP of 8.64, 6 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(4-cyano-2-pyridinyl)cyclohexyl]pyridine-4-carbonitrile is sourced from PubChem (CID 139117209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).