C21H28ClNO6 — CID 139117289
[(3S,4S,7S)-2-butyl-5-chloro-4-hydroxy-7-methyl-6,8-dioxospiro[4H-isoquinoline-3,2'-oxolane]-7-yl] butanoate (PubChem CID 139117289) has the molecular formula C21H28ClNO6 and a molecular weight of 425.91 g/mol. Its IUPAC name is [(3S,4S,7S)-2-butyl-5-chloro-4-hydroxy-7-methyl-6,8-dioxospiro[4H-isoquinoline-3,2'-oxolane]-7-yl] butanoate.
| Compound Name | [(3S,4S,7S)-2-butyl-5-chloro-4-hydroxy-7-methyl-6,8-dioxospiro[4H-isoquinoline-3,2'-oxolane]-7-yl] butanoate |
|---|---|
| PubChem CID | 139117289 |
| Molecular Formula | C21H28ClNO6 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [(3S,4S,7S)-2-butyl-5-chloro-4-hydroxy-7-methyl-6,8-dioxospiro[4H-isoquinoline-3,2'-oxolane]-7-yl] butanoate |
| SMILES | CCCCN1C=C2C(=O)[C@](C)(OC(=O)CCC)C(=O)C(Cl)=C2[C@H](O)[C@@]12CCCO2 |
| InChI | InChI=1S/C21H28ClNO6/c1-4-6-10-23-12-13-15(18(26)21(23)9-7-11-28-21)16(22)19(27)20(3,17(13)25)29-14(24)8-5-2/h12,18,26H,4-11H2,1-3H3/t18-,20-,21-/m0/s1 |
| InChIKey | IFMWVPMXRODRAN-JBACZVJFSA-N |
| XLogP | 2.60 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|