C32H22F6N4O6 — CID 139117343
ethyl 6-cyano-3-hydroxy-5-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylate (PubChem CID 139117343) has the molecular formula C32H22F6N4O6 and a molecular weight of 672.54 g/mol. Its IUPAC name is ethyl 6-cyano-3-hydroxy-5-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylate.
| Compound Name | ethyl 6-cyano-3-hydroxy-5-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 139117343 |
| Molecular Formula | C32H22F6N4O6 |
| Molecular Weight | 672.54 g/mol |
| Exact Mass | 672.14 |
| IUPAC Name | ethyl 6-cyano-3-hydroxy-5-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C#N)c(-c2ccc(C(F)(F)F)cc2)cc1O.CCOC(=O)c1nc(C#N)c(-c2ccc(C(F)(F)F)cc2)cc1O |
| InChI | InChI=1S/2C16H11F3N2O3/c2*1-2-24-15(23)14-13(22)7-11(12(8-20)21-14)9-3-5-10(6-4-9)16(17,18)19/h2*3-7,22H,2H2,1H3 |
| InChIKey | DELQDDFCNXBMJG-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 166.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.54 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |