C24H20N2O7 — CID 139117365
[(1R,2R,3R,4S)-3-hydroxy-2-methyl-3,4-diphenylcyclobutyl] 3,5-dinitrobenzoate (PubChem CID 139117365) has the molecular formula C24H20N2O7 and a molecular weight of 448.43 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-3-hydroxy-2-methyl-3,4-diphenylcyclobutyl] 3,5-dinitrobenzoate.
| Compound Name | [(1R,2R,3R,4S)-3-hydroxy-2-methyl-3,4-diphenylcyclobutyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 139117365 |
| Molecular Formula | C24H20N2O7 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [(1R,2R,3R,4S)-3-hydroxy-2-methyl-3,4-diphenylcyclobutyl] 3,5-dinitrobenzoate |
| SMILES | C[C@@H]1[C@@H](OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)[C@H](c2ccccc2)[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O7/c1-15-22(33-23(27)17-12-19(25(29)30)14-20(13-17)26(31)32)21(16-8-4-2-5-9-16)24(15,28)18-10-6-3-7-11-18/h2-15,21-22,28H,1H3/t15-,21+,22-,24+/m1/s1 |
| InChIKey | FLDJVOSPYVULFB-VOMKPBAISA-N |
| XLogP | 4.35 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|