C46H48N8O6 — CID 139117714
6,13-bis[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;ethanol (PubChem CID 139117714) has the molecular formula C46H48N8O6 and a molecular weight of 808.94 g/mol. Its IUPAC name is 6,13-bis[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;ethanol.
| Compound Name | 6,13-bis[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;ethanol |
|---|---|
| PubChem CID | 139117714 |
| Molecular Formula | C46H48N8O6 |
| Molecular Weight | 808.94 g/mol |
| Exact Mass | 808.37 |
| IUPAC Name | 6,13-bis[2-[bis(pyridin-2-ylmethyl)amino]ethyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone;ethanol |
| SMILES | CCO.CCO.O=C1c2ccc3c4c(ccc(c24)C(=O)N1CCN(Cc1ccccn1)Cc1ccccn1)C(=O)N(CCN(Cc1ccccn1)Cc1ccccn1)C3=O |
| InChI | InChI=1S/C42H36N8O4.2C2H6O/c51-39-33-13-15-35-38-36(42(54)50(41(35)53)24-22-48(27-31-11-3-7-19-45-31)28-32-12-4-8-20-46-32)16-14-34(37(33)38)40(52)49(39)23-21-47(25-29-9-1-5-17-43-29)26-30-10-2-6-18-44-30;2*1-2-3/h1-20H,21-28H2;2*3H,2H2,1H3 |
| InChIKey | MGDGMHKGUWGOKT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.94 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|