C14H20O6 — CID 139117866
(1S,3R,8S,11R)-1,8-dimethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecane-6,13-dione (PubChem CID 139117866) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is (1S,3R,8S,11R)-1,8-dimethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecane-6,13-dione.
| Compound Name | (1S,3R,8S,11R)-1,8-dimethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecane-6,13-dione |
|---|---|
| PubChem CID | 139117866 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (1S,3R,8S,11R)-1,8-dimethyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecane-6,13-dione |
| SMILES | C[C@]12CC[C@H]3OC(=O)CCC[C@]3(C)O[C@@H]1COC(=O)O2 |
| InChI | InChI=1S/C14H20O6/c1-13-6-3-4-11(15)18-9(13)5-7-14(2)10(19-13)8-17-12(16)20-14/h9-10H,3-8H2,1-2H3/t9-,10-,13+,14+/m1/s1 |
| InChIKey | BGDDFNOPQRFUOU-JYILRKAJSA-N |
| XLogP | 1.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |