C13H18O6 — CID 139117867
(1S,3R,8S,11R)-8-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecane-6,13-dione (PubChem CID 139117867) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is (1S,3R,8S,11R)-8-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecane-6,13-dione.
| Compound Name | (1S,3R,8S,11R)-8-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecane-6,13-dione |
|---|---|
| PubChem CID | 139117867 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (1S,3R,8S,11R)-8-methyl-2,5,7,12-tetraoxatricyclo[9.5.0.03,8]hexadecane-6,13-dione |
| SMILES | C[C@]12CC[C@H]3OC(=O)CCC[C@@H]3O[C@@H]1COC(=O)O2 |
| InChI | InChI=1S/C13H18O6/c1-13-6-5-9-8(3-2-4-11(14)18-9)17-10(13)7-16-12(15)19-13/h8-10H,2-7H2,1H3/t8-,9+,10+,13-/m0/s1 |
| InChIKey | HOZHJWLHCXVSIJ-WTBMIXGQSA-N |
| XLogP | 1.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |