C16H22O5 — CID 139117954
dimethyl (3aR,8Z,9aS)-9-methyl-5-oxo-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate (PubChem CID 139117954) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is dimethyl (3aR,8Z,9aS)-9-methyl-5-oxo-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aR,8Z,9aS)-9-methyl-5-oxo-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 139117954 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | dimethyl (3aR,8Z,9aS)-9-methyl-5-oxo-3,3a,4,6,7,9a-hexahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H]2CC(=O)CC/C=C(/C)[C@H]2C1 |
| InChI | InChI=1S/C16H22O5/c1-10-5-4-6-12(17)7-11-8-16(9-13(10)11,14(18)20-2)15(19)21-3/h5,11,13H,4,6-9H2,1-3H3/b10-5-/t11-,13+/m0/s1 |
| InChIKey | DZVCFFCQIGGREA-ICABLKIKSA-N |
| XLogP | 2.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|