C57H75N3O3 — CID 139118275
2,4-ditert-butyl-6-pyridin-2-ylphenol (PubChem CID 139118275) has the molecular formula C57H75N3O3 and a molecular weight of 850.25 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-pyridin-2-ylphenol.
| Compound Name | 2,4-ditert-butyl-6-pyridin-2-ylphenol |
|---|---|
| PubChem CID | 139118275 |
| Molecular Formula | C57H75N3O3 |
| Molecular Weight | 850.25 g/mol |
| Exact Mass | 849.58 |
| IUPAC Name | 2,4-ditert-butyl-6-pyridin-2-ylphenol |
| SMILES | CC(C)(C)c1cc(-c2ccccn2)c(O)c(C(C)(C)C)c1.CC(C)(C)c1cc(-c2ccccn2)c(O)c(C(C)(C)C)c1.CC(C)(C)c1cc(-c2ccccn2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/3C19H25NO/c3*1-18(2,3)13-11-14(16-9-7-8-10-20-16)17(21)15(12-13)19(4,5)6/h3*7-12,21H,1-6H3 |
| InChIKey | PHMARFYAQOYIHN-UHFFFAOYSA-N |
| XLogP | 15.15 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.25 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |