About 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one
6-hydroxy-7-phenyl-2,3-dihydroinden-1-one (PubChem CID 139118666) has the molecular formula C30H24O4
and a molecular weight of 448.52 g/mol. Its IUPAC name is 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one |
| PubChem CID | 139118666 |
| Molecular Formula | C30H24O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2ccc(O)c(-c3ccccc3)c21.O=C1CCc2ccc(O)c(-c3ccccc3)c21 |
| InChI | InChI=1S/2C15H12O2/c2*16-12-8-6-11-7-9-13(17)15(11)14(12)10-4-2-1-3-5-10/h2*1-6,8,16H,7,9H2 |
| InChIKey | LZSDSFDRIAEDQU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one?
The IUPAC name of 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one (CID 139118666) is 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one.
What is the SMILES notation for 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one?
The canonical SMILES for 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one is O=C1CCc2ccc(O)c(-c3ccccc3)c21.O=C1CCc2ccc(O)c(-c3ccccc3)c21.
What is the InChIKey of 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one?
The InChIKey is LZSDSFDRIAEDQU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H12O2/c2*16-12-8-6-11-7-9-13(17)15(11)14(12)10-4-2-1-3-5-10/h2*1-6,8,16H,7,9H2.
What are the key properties of 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one?
6-hydroxy-7-phenyl-2,3-dihydroinden-1-one has a molecular weight of 448.52 g/mol, XLogP of 6.38, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-7-phenyl-2,3-dihydroinden-1-one is sourced from PubChem (CID 139118666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).