C20H30N2O3 — CID 139119403
(4S)-N-cyclohexyl-4-(2-methylpropanoylamino)oxy-4-phenylbutanamide (PubChem CID 139119403) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is (4S)-N-cyclohexyl-4-(2-methylpropanoylamino)oxy-4-phenylbutanamide.
| Compound Name | (4S)-N-cyclohexyl-4-(2-methylpropanoylamino)oxy-4-phenylbutanamide |
|---|---|
| PubChem CID | 139119403 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (4S)-N-cyclohexyl-4-(2-methylpropanoylamino)oxy-4-phenylbutanamide |
| SMILES | CC(C)C(=O)NO[C@@H](CCC(=O)NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H30N2O3/c1-15(2)20(24)22-25-18(16-9-5-3-6-10-16)13-14-19(23)21-17-11-7-4-8-12-17/h3,5-6,9-10,15,17-18H,4,7-8,11-14H2,1-2H3,(H,21,23)(H,22,24)/t18-/m0/s1 |
| InChIKey | IPCFCLKOXHEUQZ-SFHVURJKSA-N |
| XLogP | 3.66 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|