C30H64Si3 — CID 139119560
tritert-butyl-[(1S)-4,4-ditert-butyl-5,6-diethyl-3,3-dimethyl-1,2-dihydro-1,4-disilin-1-yl]silane (PubChem CID 139119560) has the molecular formula C30H64Si3 and a molecular weight of 509.10 g/mol. Its IUPAC name is tritert-butyl-[(1S)-4,4-ditert-butyl-5,6-diethyl-3,3-dimethyl-1,2-dihydro-1,4-disilin-1-yl]silane.
| Compound Name | tritert-butyl-[(1S)-4,4-ditert-butyl-5,6-diethyl-3,3-dimethyl-1,2-dihydro-1,4-disilin-1-yl]silane |
|---|---|
| PubChem CID | 139119560 |
| Molecular Formula | C30H64Si3 |
| Molecular Weight | 509.10 g/mol |
| Exact Mass | 508.43 |
| IUPAC Name | tritert-butyl-[(1S)-4,4-ditert-butyl-5,6-diethyl-3,3-dimethyl-1,2-dihydro-1,4-disilin-1-yl]silane |
| SMILES | CCC1=C(CC)[Si](C(C)(C)C)(C(C)(C)C)C(C)(C)C[Si@@H]1[Si](C(C)(C)C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C30H64Si3/c1-20-23-24(21-2)32(25(3,4)5,26(6,7)8)30(18,19)22-31(23)33(27(9,10)11,28(12,13)14)29(15,16)17/h31H,20-22H2,1-19H3/t31-/m0/s1 |
| InChIKey | NYELQSKVAOEGTF-HKBQPEDESA-N |
| XLogP | 11.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.10 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|