C36H54O13 — CID 139120016
bis([(2S,3R,4R,5E,9S)-3,4-dihydroxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl] (2E,4E)-hexa-2,4-dienoate);hydrate (PubChem CID 139120016) has the molecular formula C36H54O13 and a molecular weight of 694.82 g/mol. Its IUPAC name is bis([(2S,3R,4R,5E,9S)-3,4-dihydroxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl] (2E,4E)-hexa-2,4-dienoate);hydrate.
| Compound Name | bis([(2S,3R,4R,5E,9S)-3,4-dihydroxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl] (2E,4E)-hexa-2,4-dienoate);hydrate |
|---|---|
| PubChem CID | 139120016 |
| Molecular Formula | C36H54O13 |
| Molecular Weight | 694.82 g/mol |
| Exact Mass | 694.36 |
| IUPAC Name | bis([(2S,3R,4R,5E,9S)-3,4-dihydroxy-10-oxo-2-propyl-2,3,4,7,8,9-hexahydrooxecin-9-yl] (2E,4E)-hexa-2,4-dienoate);hydrate |
| SMILES | C/C=C/C=C/C(=O)O[C@H]1CC/C=C/[C@@H](O)[C@@H](O)[C@H](CCC)OC1=O.C/C=C/C=C/C(=O)O[C@H]1CC/C=C/[C@@H](O)[C@@H](O)[C@H](CCC)OC1=O.O |
| InChI | InChI=1S/2C18H26O6.H2O/c2*1-3-5-6-12-16(20)23-15-11-8-7-10-13(19)17(21)14(9-4-2)24-18(15)22;/h2*3,5-7,10,12-15,17,19,21H,4,8-9,11H2,1-2H3;1H2/b2*5-3+,10-7+,12-6+;/t2*13-,14+,15+,17-;/m11./s1 |
| InChIKey | ORQYDEQBZOXROY-SQKTUOQRSA-N |
| XLogP | 2.80 |
| TPSA | 217.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.82 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|