C17H22O2 — CID 139120137
(4R)-4-[(1S)-cyclohex-2-en-1-yl]-2,2-dimethyl-4-phenyl-1,3-dioxolane (PubChem CID 139120137) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (4R)-4-[(1S)-cyclohex-2-en-1-yl]-2,2-dimethyl-4-phenyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(1S)-cyclohex-2-en-1-yl]-2,2-dimethyl-4-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 139120137 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (4R)-4-[(1S)-cyclohex-2-en-1-yl]-2,2-dimethyl-4-phenyl-1,3-dioxolane |
| SMILES | CC1(C)OC[C@](c2ccccc2)([C@@H]2C=CCCC2)O1 |
| InChI | InChI=1S/C17H22O2/c1-16(2)18-13-17(19-16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3,5-7,9-11,15H,4,8,12-13H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | MHPBOUDQDVPJTB-WBVHZDCISA-N |
| XLogP | 4.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|