C48H108Si12 — CID 139120144
trimethyl-[2,3,4-tris(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]silane (PubChem CID 139120144) has the molecular formula C48H108Si12 and a molecular weight of 1022.42 g/mol. Its IUPAC name is trimethyl-[2,3,4-tris(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]silane.
| Compound Name | trimethyl-[2,3,4-tris(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]silane |
|---|---|
| PubChem CID | 139120144 |
| Molecular Formula | C48H108Si12 |
| Molecular Weight | 1022.42 g/mol |
| Exact Mass | 1020.57 |
| IUPAC Name | trimethyl-[2,3,4-tris(trimethylsilyl)-1-tricyclo[1.1.0.02,4]butanyl]silane |
| SMILES | C[Si](C)(C)C12C3([Si](C)(C)C)C1([Si](C)(C)C)C23[Si](C)(C)C.C[Si](C)(C)C12C3([Si](C)(C)C)C1([Si](C)(C)C)C23[Si](C)(C)C.C[Si](C)(C)C12C3([Si](C)(C)C)C1([Si](C)(C)C)C23[Si](C)(C)C |
| InChI | InChI=1S/3C16H36Si4/c3*1-17(2,3)13-14(18(4,5)6)15(13,19(7,8)9)16(13,14)20(10,11)12/h3*1-12H3 |
| InChIKey | VGYDGJCOVFDFLM-UHFFFAOYSA-N |
| XLogP | 19.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.42 |
| LogP ≤ 5 | 19.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|