About [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate)
[4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate) (PubChem CID 139120352) has the molecular formula C20H28N2O4
and a molecular weight of 360.45 g/mol. Its IUPAC name is [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate).
Molecular Properties
| Compound Name | [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate) |
| PubChem CID | 139120352 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate) |
| SMILES | C/C=C/C=C/C(=O)[O-].C/C=C/C=C/C(=O)[O-].[NH3+]Cc1ccc(C[NH3+])cc1 |
| InChI | InChI=1S/C8H12N2.2C6H8O2/c9-5-7-1-2-8(6-10)4-3-7;2*1-2-3-4-5-6(7)8/h1-4H,5-6,9-10H2;2*2-5H,1H3,(H,7,8)/b;2*3-2+,5-4+ |
| InChIKey | IVJBTJDDJYFJKZ-GHBMLQDLSA-N |
| XLogP | -1.09 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate)?
The IUPAC name of [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate) (CID 139120352) is [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate).
What is the SMILES notation for [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate)?
The canonical SMILES for [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate) is C/C=C/C=C/C(=O)[O-].C/C=C/C=C/C(=O)[O-].[NH3+]Cc1ccc(C[NH3+])cc1.
What is the InChIKey of [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate)?
The InChIKey is IVJBTJDDJYFJKZ-GHBMLQDLSA-N. The full InChI is InChI=1S/C8H12N2.2C6H8O2/c9-5-7-1-2-8(6-10)4-3-7;2*1-2-3-4-5-6(7)8/h1-4H,5-6,9-10H2;2*2-5H,1H3,(H,7,8)/b;2*3-2+,5-4+.
What are the key properties of [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate)?
[4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate) has a molecular weight of 360.45 g/mol, XLogP of -1.09, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(azaniumylmethyl)phenyl]methylazanium;bis((2E,4E)-hexa-2,4-dienoate) is sourced from PubChem (CID 139120352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).