C26H18F6N2O5S2 — CID 139120550
3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-6-nitro-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methyl-6-nitro-1-benzothiophene;propan-2-one (PubChem CID 139120550) has the molecular formula C26H18F6N2O5S2 and a molecular weight of 616.56 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-6-nitro-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methyl-6-nitro-1-benzothiophene;propan-2-one.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-6-nitro-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methyl-6-nitro-1-benzothiophene;propan-2-one |
|---|---|
| PubChem CID | 139120550 |
| Molecular Formula | C26H18F6N2O5S2 |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.06 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-6-nitro-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methyl-6-nitro-1-benzothiophene;propan-2-one |
| SMILES | CC(C)=O.Cc1sc2cc([N+](=O)[O-])ccc2c1C1=C(c2c(C)sc3cc([N+](=O)[O-])ccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C23H12F6N2O4S2.C3H6O/c1-9-17(13-5-3-11(30(32)33)7-15(13)36-9)19-20(22(26,27)23(28,29)21(19,24)25)18-10(2)37-16-8-12(31(34)35)4-6-14(16)18;1-3(2)4/h3-8H,1-2H3;1-2H3 |
| InChIKey | YRNYNACYGGKDGG-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|