C12H15NO3 — CID 139120947
(1aR,2aS,6S,6aR,7aS)-6-ethyl-5-oxo-2,2a,3,6a,7,7a-hexahydro-1aH-oxireno[2,3-g]isochromene-6-carbonitrile (PubChem CID 139120947) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (1aR,2aS,6S,6aR,7aS)-6-ethyl-5-oxo-2,2a,3,6a,7,7a-hexahydro-1aH-oxireno[2,3-g]isochromene-6-carbonitrile.
| Compound Name | (1aR,2aS,6S,6aR,7aS)-6-ethyl-5-oxo-2,2a,3,6a,7,7a-hexahydro-1aH-oxireno[2,3-g]isochromene-6-carbonitrile |
|---|---|
| PubChem CID | 139120947 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (1aR,2aS,6S,6aR,7aS)-6-ethyl-5-oxo-2,2a,3,6a,7,7a-hexahydro-1aH-oxireno[2,3-g]isochromene-6-carbonitrile |
| SMILES | CC[C@]1(C#N)C(=O)OC[C@H]2C[C@H]3O[C@H]3C[C@H]21 |
| InChI | InChI=1S/C12H15NO3/c1-2-12(6-13)8-4-10-9(16-10)3-7(8)5-15-11(12)14/h7-10H,2-5H2,1H3/t7-,8-,9-,10+,12-/m1/s1 |
| InChIKey | VHIACDGLWCGMAH-APWOSFEXSA-N |
| XLogP | 1.26 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|