C30H25BF15N — CID 139120958
dicyclohexylazanium;tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139120958) has the molecular formula C30H25BF15N and a molecular weight of 695.32 g/mol. Its IUPAC name is dicyclohexylazanium;tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | dicyclohexylazanium;tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139120958 |
| Molecular Formula | C30H25BF15N |
| Molecular Weight | 695.32 g/mol |
| Exact Mass | 695.18 |
| IUPAC Name | dicyclohexylazanium;tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.Fc1c(F)c(F)c([BH-](c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C18HBF15.C12H23N/c20-4-1(5(21)11(27)16(32)10(4)26)19(2-6(22)12(28)17(33)13(29)7(2)23)3-8(24)14(30)18(34)15(31)9(3)25;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h19H;11-13H,1-10H2/q-1;/p+1 |
| InChIKey | BUYULDOCPNNOCG-UHFFFAOYSA-O |
| XLogP | 6.24 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.32 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|