C10H13NO2 — CID 139121015
(4aR,7R,7aR)-7a-methoxy-3,4,4a,7-tetrahydro-2H-cyclopenta[b]pyran-7-carbonitrile (PubChem CID 139121015) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (4aR,7R,7aR)-7a-methoxy-3,4,4a,7-tetrahydro-2H-cyclopenta[b]pyran-7-carbonitrile.
| Compound Name | (4aR,7R,7aR)-7a-methoxy-3,4,4a,7-tetrahydro-2H-cyclopenta[b]pyran-7-carbonitrile |
|---|---|
| PubChem CID | 139121015 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (4aR,7R,7aR)-7a-methoxy-3,4,4a,7-tetrahydro-2H-cyclopenta[b]pyran-7-carbonitrile |
| SMILES | CO[C@@]12OCCC[C@@H]1C=C[C@@H]2C#N |
| InChI | InChI=1S/C10H13NO2/c1-12-10-8(3-2-6-13-10)4-5-9(10)7-11/h4-5,8-9H,2-3,6H2,1H3/t8-,9-,10-/m1/s1 |
| InChIKey | CWTRRYLAKQNLAF-OPRDCNLKSA-N |
| XLogP | 1.47 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|