C16H20O4S — CID 139121021
(5aR,8S,8aR)-8-(benzenesulfonyl)-8a-methoxy-2,3,4,5,5a,8-hexahydrocyclopenta[b]oxepine (PubChem CID 139121021) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is (5aR,8S,8aR)-8-(benzenesulfonyl)-8a-methoxy-2,3,4,5,5a,8-hexahydrocyclopenta[b]oxepine.
| Compound Name | (5aR,8S,8aR)-8-(benzenesulfonyl)-8a-methoxy-2,3,4,5,5a,8-hexahydrocyclopenta[b]oxepine |
|---|---|
| PubChem CID | 139121021 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (5aR,8S,8aR)-8-(benzenesulfonyl)-8a-methoxy-2,3,4,5,5a,8-hexahydrocyclopenta[b]oxepine |
| SMILES | CO[C@@]12OCCCC[C@@H]1C=C[C@@H]2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O4S/c1-19-16-13(7-5-6-12-20-16)10-11-15(16)21(17,18)14-8-3-2-4-9-14/h2-4,8-11,13,15H,5-7,12H2,1H3/t13-,15+,16-/m1/s1 |
| InChIKey | GDKSCONDWAAEKZ-VNQPRFMTSA-N |
| XLogP | 2.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|