C39H33BF10NOP — CID 139121195
5,5-bis(2,3,4,5,6-pentafluorophenyl)-1-phenylmethoxy-2,2-bis(2,4,6-trimethylphenyl)-1-azonia-2λ5-phospha-5-boranuidacyclopentene (PubChem CID 139121195) has the molecular formula C39H33BF10NOP and a molecular weight of 763.47 g/mol. Its IUPAC name is 5,5-bis(2,3,4,5,6-pentafluorophenyl)-1-phenylmethoxy-2,2-bis(2,4,6-trimethylphenyl)-1-azonia-2λ5-phospha-5-boranuidacyclopentene.
| Compound Name | 5,5-bis(2,3,4,5,6-pentafluorophenyl)-1-phenylmethoxy-2,2-bis(2,4,6-trimethylphenyl)-1-azonia-2λ5-phospha-5-boranuidacyclopentene |
|---|---|
| PubChem CID | 139121195 |
| Molecular Formula | C39H33BF10NOP |
| Molecular Weight | 763.47 g/mol |
| Exact Mass | 763.22 |
| IUPAC Name | 5,5-bis(2,3,4,5,6-pentafluorophenyl)-1-phenylmethoxy-2,2-bis(2,4,6-trimethylphenyl)-1-azonia-2λ5-phospha-5-boranuidacyclopentene |
| SMILES | Cc1cc(C)c(P2(c3c(C)cc(C)cc3C)=[N+](OCc3ccccc3)[B-](c3c(F)c(F)c(F)c(F)c3F)(c3c(F)c(F)c(F)c(F)c3F)CC2)c(C)c1 |
| InChI | InChI=1S/C39H33BF10NOP/c1-19-14-21(3)38(22(4)15-19)53(39-23(5)16-20(2)17-24(39)6)13-12-40(51(53)52-18-25-10-8-7-9-11-25,26-28(41)32(45)36(49)33(46)29(26)42)27-30(43)34(47)37(50)35(48)31(27)44/h7-11,14-17H,12-13,18H2,1-6H3 |
| InChIKey | PPIMAJIEUQIGON-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.47 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|