C30H31F6N3O4 — CID 139121214
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (1S,2R)-2-azido-1-[3,5-bis(trifluoromethyl)benzoyl]oxy-3,4-dihydro-1H-naphthalene-2-carboxylate (PubChem CID 139121214) has the molecular formula C30H31F6N3O4 and a molecular weight of 611.58 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (1S,2R)-2-azido-1-[3,5-bis(trifluoromethyl)benzoyl]oxy-3,4-dihydro-1H-naphthalene-2-carboxylate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (1S,2R)-2-azido-1-[3,5-bis(trifluoromethyl)benzoyl]oxy-3,4-dihydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139121214 |
| Molecular Formula | C30H31F6N3O4 |
| Molecular Weight | 611.58 g/mol |
| Exact Mass | 611.22 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (1S,2R)-2-azido-1-[3,5-bis(trifluoromethyl)benzoyl]oxy-3,4-dihydro-1H-naphthalene-2-carboxylate |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(=O)[C@@]1(N=[N+]=[N-])CCc2ccccc2[C@@H]1OC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H31F6N3O4/c1-16(2)22-9-8-17(3)12-24(22)42-27(41)28(38-39-37)11-10-18-6-4-5-7-23(18)25(28)43-26(40)19-13-20(29(31,32)33)15-21(14-19)30(34,35)36/h4-7,13-17,22,24-25H,8-12H2,1-3H3/t17-,22+,24-,25-,28+/m0/s1 |
| InChIKey | BQRPIJBEQOGYAV-NUZAXQFISA-N |
| XLogP | 8.62 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.58 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|