C12H24O2Si — CID 139121325
(1S,5R,6R,7R)-5,7-dimethyl-6-trimethylsilyl-8-oxabicyclo[3.2.1]octan-1-ol (PubChem CID 139121325) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is (1S,5R,6R,7R)-5,7-dimethyl-6-trimethylsilyl-8-oxabicyclo[3.2.1]octan-1-ol.
| Compound Name | (1S,5R,6R,7R)-5,7-dimethyl-6-trimethylsilyl-8-oxabicyclo[3.2.1]octan-1-ol |
|---|---|
| PubChem CID | 139121325 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (1S,5R,6R,7R)-5,7-dimethyl-6-trimethylsilyl-8-oxabicyclo[3.2.1]octan-1-ol |
| SMILES | C[C@H]1[C@@H]([Si](C)(C)C)[C@@]2(C)CCC[C@]1(O)O2 |
| InChI | InChI=1S/C12H24O2Si/c1-9-10(15(3,4)5)11(2)7-6-8-12(9,13)14-11/h9-10,13H,6-8H2,1-5H3/t9-,10+,11+,12-/m0/s1 |
| InChIKey | SQJDCCWLGPRWGC-QCNOEVLYSA-N |
| XLogP | 2.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|