C21H34OSi — CID 139121340
(3S,5R)-2,2-ditert-butyl-3-ethenyl-4,4-dimethyl-5-phenyloxasilolane (PubChem CID 139121340) has the molecular formula C21H34OSi and a molecular weight of 330.59 g/mol. Its IUPAC name is (3S,5R)-2,2-ditert-butyl-3-ethenyl-4,4-dimethyl-5-phenyloxasilolane.
| Compound Name | (3S,5R)-2,2-ditert-butyl-3-ethenyl-4,4-dimethyl-5-phenyloxasilolane |
|---|---|
| PubChem CID | 139121340 |
| Molecular Formula | C21H34OSi |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (3S,5R)-2,2-ditert-butyl-3-ethenyl-4,4-dimethyl-5-phenyloxasilolane |
| SMILES | C=C[C@H]1C(C)(C)[C@@H](c2ccccc2)O[Si]1(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C21H34OSi/c1-10-17-21(8,9)18(16-14-12-11-13-15-16)22-23(17,19(2,3)4)20(5,6)7/h10-15,17-18H,1H2,2-9H3/t17-,18+/m0/s1 |
| InChIKey | DSRXLTGOOKUUCV-ZWKOTPCHSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|