C58H48N6P2S2 — CID 139121523
2-[(2,6-dipyridin-2-yl-4-pyridinyl)sulfanyl]ethyl-diphenylphosphane (PubChem CID 139121523) has the molecular formula C58H48N6P2S2 and a molecular weight of 955.15 g/mol. Its IUPAC name is 2-[(2,6-dipyridin-2-yl-4-pyridinyl)sulfanyl]ethyl-diphenylphosphane.
| Compound Name | 2-[(2,6-dipyridin-2-yl-4-pyridinyl)sulfanyl]ethyl-diphenylphosphane |
|---|---|
| PubChem CID | 139121523 |
| Molecular Formula | C58H48N6P2S2 |
| Molecular Weight | 955.15 g/mol |
| Exact Mass | 954.29 |
| IUPAC Name | 2-[(2,6-dipyridin-2-yl-4-pyridinyl)sulfanyl]ethyl-diphenylphosphane |
| SMILES | c1ccc(P(CCSc2cc(-c3ccccn3)nc(-c3ccccn3)c2)c2ccccc2)cc1.c1ccc(P(CCSc2cc(-c3ccccn3)nc(-c3ccccn3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C29H24N3PS/c2*1-3-11-23(12-4-1)33(24-13-5-2-6-14-24)19-20-34-25-21-28(26-15-7-9-17-30-26)32-29(22-25)27-16-8-10-18-31-27/h2*1-18,21-22H,19-20H2 |
| InChIKey | ZVHQKVATYSXQDN-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.15 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|