C42H38N6O8 — CID 139121600
5-nitro-2-[(2S,3R)-4-nitro-1,3-diphenylbutan-2-yl]pyridine (PubChem CID 139121600) has the molecular formula C42H38N6O8 and a molecular weight of 754.80 g/mol. Its IUPAC name is 5-nitro-2-[(2S,3R)-4-nitro-1,3-diphenylbutan-2-yl]pyridine.
| Compound Name | 5-nitro-2-[(2S,3R)-4-nitro-1,3-diphenylbutan-2-yl]pyridine |
|---|---|
| PubChem CID | 139121600 |
| Molecular Formula | C42H38N6O8 |
| Molecular Weight | 754.80 g/mol |
| Exact Mass | 754.28 |
| IUPAC Name | 5-nitro-2-[(2S,3R)-4-nitro-1,3-diphenylbutan-2-yl]pyridine |
| SMILES | O=[N+]([O-])C[C@@H](c1ccccc1)[C@H](Cc1ccccc1)c1ccc([N+](=O)[O-])cn1.O=[N+]([O-])C[C@@H](c1ccccc1)[C@H](Cc1ccccc1)c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/2C21H19N3O4/c2*25-23(26)15-20(17-9-5-2-6-10-17)19(13-16-7-3-1-4-8-16)21-12-11-18(14-22-21)24(27)28/h2*1-12,14,19-20H,13,15H2/t2*19-,20-/m00/s1 |
| InChIKey | XXFHOTNKCHGLCR-SDIJQETESA-N |
| XLogP | 8.75 |
| TPSA | 198.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.80 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|