C20H12Br2N4O4 — CID 139121928
2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;2,3-dipyridin-2-ylpyrazin-1-ium (PubChem CID 139121928) has the molecular formula C20H12Br2N4O4 and a molecular weight of 532.15 g/mol. Its IUPAC name is 2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;2,3-dipyridin-2-ylpyrazin-1-ium.
| Compound Name | 2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;2,3-dipyridin-2-ylpyrazin-1-ium |
|---|---|
| PubChem CID | 139121928 |
| Molecular Formula | C20H12Br2N4O4 |
| Molecular Weight | 532.15 g/mol |
| Exact Mass | 529.92 |
| IUPAC Name | 2,5-dibromo-4-hydroxy-3,6-dioxocyclohexa-1,4-dien-1-olate;2,3-dipyridin-2-ylpyrazin-1-ium |
| SMILES | O=C1C(O)=C(Br)C(=O)C([O-])=C1Br.c1ccc(-c2ncc[nH+]c2-c2ccccn2)nc1 |
| InChI | InChI=1S/C14H10N4.C6H2Br2O4/c1-3-7-15-11(5-1)13-14(18-10-9-17-13)12-6-2-4-8-16-12;7-1-3(9)5(11)2(8)6(12)4(1)10/h1-10H;9,12H |
| InChIKey | GZTOXXYRDIVKRH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.15 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|